C15H20ClN3O — CID 65290889
6-amino-N-(5-chloro-2-cyanophenyl)-4,4-dimethylhexanamide (PubChem CID 65290889) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 6-amino-N-(5-chloro-2-cyanophenyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-(5-chloro-2-cyanophenyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65290889 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 6-amino-N-(5-chloro-2-cyanophenyl)-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C15H20ClN3O/c1-15(2,7-8-17)6-5-14(20)19-13-9-12(16)4-3-11(13)10-18/h3-4,9H,5-8,17H2,1-2H3,(H,19,20) |
| InChIKey | INMLFJDPNCBJSH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |