C15H21N3O — CID 65292791
6-amino-N-(2-cyanophenyl)-4,4-dimethylhexanamide (PubChem CID 65292791) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 6-amino-N-(2-cyanophenyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-(2-cyanophenyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65292791 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 6-amino-N-(2-cyanophenyl)-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C15H21N3O/c1-15(2,9-10-16)8-7-14(19)18-13-6-4-3-5-12(13)11-17/h3-6H,7-10,16H2,1-2H3,(H,18,19) |
| InChIKey | VFFXHTYIJJJREV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |