C25H23NO2 — CID 164675470
methyl (3S)-1-benzhydryl-3-phenyl-2,3-dihydropyrrole-4-carboxylate (PubChem CID 164675470) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is methyl (3S)-1-benzhydryl-3-phenyl-2,3-dihydropyrrole-4-carboxylate.
| Compound Name | methyl (3S)-1-benzhydryl-3-phenyl-2,3-dihydropyrrole-4-carboxylate |
|---|---|
| PubChem CID | 164675470 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl (3S)-1-benzhydryl-3-phenyl-2,3-dihydropyrrole-4-carboxylate |
| SMILES | COC(=O)C1=CN(C(c2ccccc2)c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-28-25(27)23-18-26(17-22(23)19-11-5-2-6-12-19)24(20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,18,22,24H,17H2,1H3/t22-/m0/s1 |
| InChIKey | JBVXISAXGQJVST-QFIPXVFZSA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |