C20H28O — CID 164675719
(3R,9Z,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6,9-trien-5-one (PubChem CID 164675719) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (3R,9Z,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6,9-trien-5-one.
| Compound Name | (3R,9Z,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6,9-trien-5-one |
|---|---|
| PubChem CID | 164675719 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (3R,9Z,11S)-3,10,14-trimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradeca-1(14),6,9-trien-5-one |
| SMILES | CC1=C2C[C@]3(C)CC(=O)C(C(C)C)=C3C/C=C(/C)[C@@H]2CC1 |
| InChI | InChI=1S/C20H28O/c1-12(2)19-17-9-7-13(3)15-8-6-14(4)16(15)10-20(17,5)11-18(19)21/h7,12,15H,6,8-11H2,1-5H3/b13-7-/t15-,20+/m0/s1 |
| InChIKey | NVTOYNKKDQAWMM-GBLUPTFBSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|