C36H50O — CID 145081980
3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one (PubChem CID 145081980) has the molecular formula C36H50O and a molecular weight of 498.80 g/mol. Its IUPAC name is 3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one.
| Compound Name | 3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one |
|---|---|
| PubChem CID | 145081980 |
| Molecular Formula | C36H50O |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | 3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one |
| SMILES | Cc1ccc(C2=CCC3(C)C(CCC4(C)C5CCC6(C)CC(=O)C(C(C)C)=C6C5CCC43)C2(C)C)cc1 |
| InChI | InChI=1S/C36H50O/c1-22(2)31-28(37)21-34(6)18-15-27-25(32(31)34)13-14-30-35(27,7)20-17-29-33(4,5)26(16-19-36(29,30)8)24-11-9-23(3)10-12-24/h9-12,16,22,25,27,29-30H,13-15,17-21H2,1-8H3 |
| InChIKey | IONPFVAAHHUJQV-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |