C46H69NO3 — CID 145237815
tert-butyl 4-[3a-[2-(cyclopropylmethylamino)ethyl]-5b,8,11a-trimethyl-2-oxo-1-propan-2-yl-4,5,5a,6,7,7a,8,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl]benzoate;ethane (PubChem CID 145237815) has the molecular formula C46H69NO3 and a molecular weight of 684.06 g/mol. Its IUPAC name is tert-butyl 4-[3a-[2-(cyclopropylmethylamino)ethyl]-5b,8,11a-trimethyl-2-oxo-1-propan-2-yl-4,5,5a,6,7,7a,8,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl]benzoate;ethane.
| Compound Name | tert-butyl 4-[3a-[2-(cyclopropylmethylamino)ethyl]-5b,8,11a-trimethyl-2-oxo-1-propan-2-yl-4,5,5a,6,7,7a,8,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl]benzoate;ethane |
|---|---|
| PubChem CID | 145237815 |
| Molecular Formula | C46H69NO3 |
| Molecular Weight | 684.06 g/mol |
| Exact Mass | 683.53 |
| IUPAC Name | tert-butyl 4-[3a-[2-(cyclopropylmethylamino)ethyl]-5b,8,11a-trimethyl-2-oxo-1-propan-2-yl-4,5,5a,6,7,7a,8,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl]benzoate;ethane |
| SMILES | CC.CC(C)C1=C2C3CCC4C5(C)CC=C(c6ccc(C(=O)OC(C)(C)C)cc6)C(C)C5CCC4(C)C3CCC2(CCNCC2CC2)CC1=O |
| InChI | InChI=1S/C44H63NO3.C2H6/c1-27(2)38-36(46)25-44(23-24-45-26-29-9-10-29)22-19-35-33(39(38)44)15-16-37-42(7)20-17-32(28(3)34(42)18-21-43(35,37)8)30-11-13-31(14-12-30)40(47)48-41(4,5)6;1-2/h11-14,17,27-29,33-35,37,45H,9-10,15-16,18-26H2,1-8H3;1-2H3 |
| InChIKey | UZQJISVBJGALDB-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.06 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|