C37H52O3 — CID 145081979
3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one;formic acid (PubChem CID 145081979) has the molecular formula C37H52O3 and a molecular weight of 544.82 g/mol. Its IUPAC name is 3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one;formic acid.
| Compound Name | 3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one;formic acid |
|---|---|
| PubChem CID | 145081979 |
| Molecular Formula | C37H52O3 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | 3a,5b,8,8,11a-pentamethyl-9-(4-methylphenyl)-1-propan-2-yl-3,4,5,5a,6,7,7a,11,11b,12,13,13a-dodecahydrocyclopenta[a]chrysen-2-one;formic acid |
| SMILES | Cc1ccc(C2=CCC3(C)C(CCC4(C)C5CCC6(C)CC(=O)C(C(C)C)=C6C5CCC43)C2(C)C)cc1.O=CO |
| InChI | InChI=1S/C36H50O.CH2O2/c1-22(2)31-28(37)21-34(6)18-15-27-25(32(31)34)13-14-30-35(27,7)20-17-29-33(4,5)26(16-19-36(29,30)8)24-11-9-23(3)10-12-24;2-1-3/h9-12,16,22,25,27,29-30H,13-15,17-21H2,1-8H3;1H,(H,2,3) |
| InChIKey | FODDMRVHKPLYHX-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|