C35H54O2 — CID 145170809
4-(1,1,4a,8,8,10b-hexamethyl-7-propyl-4,4b,5,6,6a,7,9,10,10a,11,12,12a-dodecahydrochrysen-2-yl)benzoic acid;methane (PubChem CID 145170809) has the molecular formula C35H54O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is 4-(1,1,4a,8,8,10b-hexamethyl-7-propyl-4,4b,5,6,6a,7,9,10,10a,11,12,12a-dodecahydrochrysen-2-yl)benzoic acid;methane.
| Compound Name | 4-(1,1,4a,8,8,10b-hexamethyl-7-propyl-4,4b,5,6,6a,7,9,10,10a,11,12,12a-dodecahydrochrysen-2-yl)benzoic acid;methane |
|---|---|
| PubChem CID | 145170809 |
| Molecular Formula | C35H54O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | 4-(1,1,4a,8,8,10b-hexamethyl-7-propyl-4,4b,5,6,6a,7,9,10,10a,11,12,12a-dodecahydrochrysen-2-yl)benzoic acid;methane |
| SMILES | C.CCCC1C2CCC3C(C)(CCC4C(C)(C)C(c5ccc(C(=O)O)cc5)=CCC43C)C2CCC1(C)C |
| InChI | InChI=1S/C34H50O2.CH4/c1-8-9-26-24-14-15-29-33(6,27(24)16-19-31(26,2)3)21-18-28-32(4,5)25(17-20-34(28,29)7)22-10-12-23(13-11-22)30(35)36;/h10-13,17,24,26-29H,8-9,14-16,18-21H2,1-7H3,(H,35,36);1H4 |
| InChIKey | XITRJTJQWJJYBL-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |