C38H56N2O3S — CID 144681927
4-[(13bR)-5b,8,8,11a-tetramethyl-3a-[2-(1-oxo-1,4-thiazinan-4-yl)ethylamino]-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 144681927) has the molecular formula C38H56N2O3S and a molecular weight of 620.94 g/mol. Its IUPAC name is 4-[(13bR)-5b,8,8,11a-tetramethyl-3a-[2-(1-oxo-1,4-thiazinan-4-yl)ethylamino]-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[(13bR)-5b,8,8,11a-tetramethyl-3a-[2-(1-oxo-1,4-thiazinan-4-yl)ethylamino]-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 144681927 |
| Molecular Formula | C38H56N2O3S |
| Molecular Weight | 620.94 g/mol |
| Exact Mass | 620.40 |
| IUPAC Name | 4-[(13bR)-5b,8,8,11a-tetramethyl-3a-[2-(1-oxo-1,4-thiazinan-4-yl)ethylamino]-2,3,4,5,5a,6,7,7a,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | CC1(C)C(c2ccc(C(=O)O)cc2)=CCC2(C)C1CCC1(C)C3CCC4(NCCN5CCS(=O)CC5)CCC[C@@H]4C3CCC12 |
| InChI | InChI=1S/C38H56N2O3S/c1-35(2)29(26-7-9-27(10-8-26)34(41)42)13-17-37(4)32(35)15-18-36(3)30-14-19-38(39-20-21-40-22-24-44(43)25-23-40)16-5-6-31(38)28(30)11-12-33(36)37/h7-10,13,28,30-33,39H,5-6,11-12,14-25H2,1-4H3,(H,41,42)/t28?,30?,31-,32?,33?,36?,37?,38?/m1/s1 |
| InChIKey | MYZLWYGYYGZYJF-ASXUKEKLSA-N |
| XLogP | 7.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.94 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |