C42H64N2O2S — CID 123806925
4-[1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-5-[2-(thiazinan-2-yl)ethylamino]-17-tetracyclo[11.8.0.05,9.014,19]henicos-16-enyl]benzoic acid (PubChem CID 123806925) has the molecular formula C42H64N2O2S and a molecular weight of 661.05 g/mol. Its IUPAC name is 4-[1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-5-[2-(thiazinan-2-yl)ethylamino]-17-tetracyclo[11.8.0.05,9.014,19]henicos-16-enyl]benzoic acid.
| Compound Name | 4-[1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-5-[2-(thiazinan-2-yl)ethylamino]-17-tetracyclo[11.8.0.05,9.014,19]henicos-16-enyl]benzoic acid |
|---|---|
| PubChem CID | 123806925 |
| Molecular Formula | C42H64N2O2S |
| Molecular Weight | 661.05 g/mol |
| Exact Mass | 660.47 |
| IUPAC Name | 4-[1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-5-[2-(thiazinan-2-yl)ethylamino]-17-tetracyclo[11.8.0.05,9.014,19]henicos-16-enyl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCCN3CCCCS3)CCC(C)C3(C)CCC4C(C)(C)C(c5ccc(C(=O)O)cc5)=CCC4(C)C3CCCC12 |
| InChI | InChI=1S/C42H64N2O2S/c1-29(2)33-18-24-42(43-25-27-44-26-8-9-28-47-44)23-17-30(3)40(6)22-20-36-39(4,5)34(31-13-15-32(16-14-31)38(45)46)19-21-41(36,7)37(40)12-10-11-35(33)42/h13-16,19,30,33,35-37,43H,1,8-12,17-18,20-28H2,2-7H3,(H,45,46) |
| InChIKey | QFQLKSKZJSUEHD-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.05 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|