C16H12Cl3NO — CID 164678494
4,5-diphenyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 164678494) has the molecular formula C16H12Cl3NO and a molecular weight of 340.64 g/mol. Its IUPAC name is 4,5-diphenyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4,5-diphenyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 164678494 |
| Molecular Formula | C16H12Cl3NO |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 4,5-diphenyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | ClC(Cl)(Cl)C1=NC(c2ccccc2)C(c2ccccc2)O1 |
| InChI | InChI=1S/C16H12Cl3NO/c17-16(18,19)15-20-13(11-7-3-1-4-8-11)14(21-15)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | CDEDGJWJNMTSQT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|