C19H23NO6 — CID 164678711
2-ethyl-2-[(5-oxo-3-phenyl-4-propyl-1,2-oxazol-4-yl)oxycarbonyl]butanoic acid (PubChem CID 164678711) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-ethyl-2-[(5-oxo-3-phenyl-4-propyl-1,2-oxazol-4-yl)oxycarbonyl]butanoic acid.
| Compound Name | 2-ethyl-2-[(5-oxo-3-phenyl-4-propyl-1,2-oxazol-4-yl)oxycarbonyl]butanoic acid |
|---|---|
| PubChem CID | 164678711 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-ethyl-2-[(5-oxo-3-phenyl-4-propyl-1,2-oxazol-4-yl)oxycarbonyl]butanoic acid |
| SMILES | CCCC1(OC(=O)C(CC)(CC)C(=O)O)C(=O)ON=C1c1ccccc1 |
| InChI | InChI=1S/C19H23NO6/c1-4-12-19(25-16(23)18(5-2,6-3)15(21)22)14(20-26-17(19)24)13-10-8-7-9-11-13/h7-11H,4-6,12H2,1-3H3,(H,21,22) |
| InChIKey | CJMOJNLBEPUIJY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|