C18H21NO6 — CID 164678710
2-[(4-benzyl-3-methyl-5-oxo-1,2-oxazol-4-yl)oxycarbonyl]-2-ethylbutanoic acid (PubChem CID 164678710) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[(4-benzyl-3-methyl-5-oxo-1,2-oxazol-4-yl)oxycarbonyl]-2-ethylbutanoic acid.
| Compound Name | 2-[(4-benzyl-3-methyl-5-oxo-1,2-oxazol-4-yl)oxycarbonyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 164678710 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-[(4-benzyl-3-methyl-5-oxo-1,2-oxazol-4-yl)oxycarbonyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)OC1(Cc2ccccc2)C(=O)ON=C1C |
| InChI | InChI=1S/C18H21NO6/c1-4-17(5-2,14(20)21)15(22)24-18(12(3)19-25-16(18)23)11-13-9-7-6-8-10-13/h6-10H,4-5,11H2,1-3H3,(H,20,21) |
| InChIKey | JERNXUJQZRRDLY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|