C18H25NO6 — CID 134974279
dimethyl 2-[(2Z)-5-hydroxy-2-hydroxyimino-5-methyl-3-phenylhexyl]propanedioate (PubChem CID 134974279) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is dimethyl 2-[(2Z)-5-hydroxy-2-hydroxyimino-5-methyl-3-phenylhexyl]propanedioate.
| Compound Name | dimethyl 2-[(2Z)-5-hydroxy-2-hydroxyimino-5-methyl-3-phenylhexyl]propanedioate |
|---|---|
| PubChem CID | 134974279 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | dimethyl 2-[(2Z)-5-hydroxy-2-hydroxyimino-5-methyl-3-phenylhexyl]propanedioate |
| SMILES | COC(=O)C(C/C(=N/O)C(CC(C)(C)O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C18H25NO6/c1-18(2,22)11-14(12-8-6-5-7-9-12)15(19-23)10-13(16(20)24-3)17(21)25-4/h5-9,13-14,22-23H,10-11H2,1-4H3/b19-15- |
| InChIKey | FNRUWHUQTAEDQI-CYVLTUHYSA-N |
| XLogP | 2.11 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|