C11H11FN2O4 — CID 164678788
methyl 3-fluoro-6-methoxy-1-methyl-2-oxopyrrolo[2,3-b]pyridine-3-carboxylate (PubChem CID 164678788) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is methyl 3-fluoro-6-methoxy-1-methyl-2-oxopyrrolo[2,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 3-fluoro-6-methoxy-1-methyl-2-oxopyrrolo[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164678788 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | methyl 3-fluoro-6-methoxy-1-methyl-2-oxopyrrolo[2,3-b]pyridine-3-carboxylate |
| SMILES | COC(=O)C1(F)C(=O)N(C)c2nc(OC)ccc21 |
| InChI | InChI=1S/C11H11FN2O4/c1-14-8-6(4-5-7(13-8)17-2)11(12,9(14)15)10(16)18-3/h4-5H,1-3H3 |
| InChIKey | JWBVWSLLNPCKLL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|