C9H8N2O3 — CID 175286478
(2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-6-yl) acetate (PubChem CID 175286478) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is (2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-6-yl) acetate.
| Compound Name | (2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-6-yl) acetate |
|---|---|
| PubChem CID | 175286478 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-6-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(n1)NC(=O)C2 |
| InChI | InChI=1S/C9H8N2O3/c1-5(12)14-8-3-2-6-4-7(13)10-9(6)11-8/h2-3H,4H2,1H3,(H,10,11,13) |
| InChIKey | KPKASMDFPGPYTO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |