C24H32FNO8 — CID 164678837
1-O,1-O-diethyl 4-O-methyl (E)-1-[(R)-(3-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]but-3-ene-1,1,4-tricarboxylate (PubChem CID 164678837) has the molecular formula C24H32FNO8 and a molecular weight of 481.52 g/mol. Its IUPAC name is 1-O,1-O-diethyl 4-O-methyl (E)-1-[(R)-(3-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]but-3-ene-1,1,4-tricarboxylate.
| Compound Name | 1-O,1-O-diethyl 4-O-methyl (E)-1-[(R)-(3-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]but-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 164678837 |
| Molecular Formula | C24H32FNO8 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-O,1-O-diethyl 4-O-methyl (E)-1-[(R)-(3-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]but-3-ene-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)C(C/C=C/C(=O)OC)(C(=O)OCC)[C@H](NC(=O)OC(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C24H32FNO8/c1-7-32-20(28)24(21(29)33-8-2,14-10-13-18(27)31-6)19(16-11-9-12-17(25)15-16)26-22(30)34-23(3,4)5/h9-13,15,19H,7-8,14H2,1-6H3,(H,26,30)/b13-10+/t19-/m1/s1 |
| InChIKey | XSTAYHUOESZJPV-YFPIXMDGSA-N |
| XLogP | 3.62 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|