C21H24N2 — CID 164679251
1-[(1E,3E)-1,4-diphenylbuta-1,3-dienyl]-4-methylpiperazine (PubChem CID 164679251) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-[(1E,3E)-1,4-diphenylbuta-1,3-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(1E,3E)-1,4-diphenylbuta-1,3-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 164679251 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-[(1E,3E)-1,4-diphenylbuta-1,3-dienyl]-4-methylpiperazine |
| SMILES | CN1CCN(/C(=C/C=C/c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2/c1-22-15-17-23(18-16-22)21(20-12-6-3-7-13-20)14-8-11-19-9-4-2-5-10-19/h2-14H,15-18H2,1H3/b11-8+,21-14+ |
| InChIKey | KQVSNBGOXCTNLR-DYTMQZIQSA-N |
| XLogP | 3.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|