C20H19Cl2NO — CID 164679252
4-[(1E,3E)-1,4-bis(4-chlorophenyl)buta-1,3-dienyl]morpholine (PubChem CID 164679252) has the molecular formula C20H19Cl2NO and a molecular weight of 360.28 g/mol. Its IUPAC name is 4-[(1E,3E)-1,4-bis(4-chlorophenyl)buta-1,3-dienyl]morpholine.
| Compound Name | 4-[(1E,3E)-1,4-bis(4-chlorophenyl)buta-1,3-dienyl]morpholine |
|---|---|
| PubChem CID | 164679252 |
| Molecular Formula | C20H19Cl2NO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-[(1E,3E)-1,4-bis(4-chlorophenyl)buta-1,3-dienyl]morpholine |
| SMILES | Clc1ccc(/C=C/C=C(\c2ccc(Cl)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H19Cl2NO/c21-18-8-4-16(5-9-18)2-1-3-20(23-12-14-24-15-13-23)17-6-10-19(22)11-7-17/h1-11H,12-15H2/b2-1+,20-3+ |
| InChIKey | BHXYFLOPJWHCPY-PFJUMCMMSA-N |
| XLogP | 5.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|