C11H20N2O5S2 — CID 164681486
[(2S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-dimethylcarbamodithioate (PubChem CID 164681486) has the molecular formula C11H20N2O5S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(2S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-dimethylcarbamodithioate.
| Compound Name | [(2S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 164681486 |
| Molecular Formula | C11H20N2O5S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(2S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-dimethylcarbamodithioate |
| SMILES | CC(=O)NC1C(O)[C@H](O)C(CO)O[C@H]1SC(=S)N(C)C |
| InChI | InChI=1S/C11H20N2O5S2/c1-5(15)12-7-9(17)8(16)6(4-14)18-10(7)20-11(19)13(2)3/h6-10,14,16-17H,4H2,1-3H3,(H,12,15)/t6?,7?,8-,9?,10+/m1/s1 |
| InChIKey | RPNBGHNLLNTXOI-HPJYYENKSA-N |
| XLogP | -1.49 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|