C19H35NO4PSi- — CID 164682108
(Z)-(2-diethoxyphosphoryl-3-trimethylsilylcyclopenta-2,4-dien-1-ylidene)-[di(propan-2-yl)amino]methanolate (PubChem CID 164682108) has the molecular formula C19H35NO4PSi- and a molecular weight of 400.55 g/mol. Its IUPAC name is (Z)-(2-diethoxyphosphoryl-3-trimethylsilylcyclopenta-2,4-dien-1-ylidene)-[di(propan-2-yl)amino]methanolate.
| Compound Name | (Z)-(2-diethoxyphosphoryl-3-trimethylsilylcyclopenta-2,4-dien-1-ylidene)-[di(propan-2-yl)amino]methanolate |
|---|---|
| PubChem CID | 164682108 |
| Molecular Formula | C19H35NO4PSi- |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (Z)-(2-diethoxyphosphoryl-3-trimethylsilylcyclopenta-2,4-dien-1-ylidene)-[di(propan-2-yl)amino]methanolate |
| SMILES | CCOP(=O)(OCC)C1=C([Si](C)(C)C)C=C/C1=C(/[O-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36NO4PSi/c1-10-23-25(22,24-11-2)18-16(12-13-17(18)26(7,8)9)19(21)20(14(3)4)15(5)6/h12-15,21H,10-11H2,1-9H3/p-1/b19-16- |
| InChIKey | FXOVALGFVOLFJU-MNDPQUGUSA-M |
| XLogP | 4.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|