C20H17BrFNO3 — CID 164682582
methyl (2S,3S)-2-(4-bromo-2-fluorophenyl)-1-methyl-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate (PubChem CID 164682582) has the molecular formula C20H17BrFNO3 and a molecular weight of 418.26 g/mol. Its IUPAC name is methyl (2S,3S)-2-(4-bromo-2-fluorophenyl)-1-methyl-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate.
| Compound Name | methyl (2S,3S)-2-(4-bromo-2-fluorophenyl)-1-methyl-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 164682582 |
| Molecular Formula | C20H17BrFNO3 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | methyl (2S,3S)-2-(4-bromo-2-fluorophenyl)-1-methyl-4-oxo-3-[(E)-2-phenylethenyl]azetidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(/C=C/c2ccccc2)C(=O)N(C)[C@@H]1c1ccc(Br)cc1F |
| InChI | InChI=1S/C20H17BrFNO3/c1-23-17(15-9-8-14(21)12-16(15)22)20(18(23)24,19(25)26-2)11-10-13-6-4-3-5-7-13/h3-12,17H,1-2H3/b11-10+/t17-,20+/m1/s1 |
| InChIKey | KGQYMAICJRJLKL-IPNAJESVSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|