C20H17F2NO3 — CID 164682705
methyl (2R,3S)-2-(4-fluorophenyl)-3-[(E)-2-(4-fluorophenyl)ethenyl]-1-methyl-4-oxoazetidine-3-carboxylate (PubChem CID 164682705) has the molecular formula C20H17F2NO3 and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl (2R,3S)-2-(4-fluorophenyl)-3-[(E)-2-(4-fluorophenyl)ethenyl]-1-methyl-4-oxoazetidine-3-carboxylate.
| Compound Name | methyl (2R,3S)-2-(4-fluorophenyl)-3-[(E)-2-(4-fluorophenyl)ethenyl]-1-methyl-4-oxoazetidine-3-carboxylate |
|---|---|
| PubChem CID | 164682705 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl (2R,3S)-2-(4-fluorophenyl)-3-[(E)-2-(4-fluorophenyl)ethenyl]-1-methyl-4-oxoazetidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(/C=C/c2ccc(F)cc2)C(=O)N(C)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17F2NO3/c1-23-17(14-5-9-16(22)10-6-14)20(18(23)24,19(25)26-2)12-11-13-3-7-15(21)8-4-13/h3-12,17H,1-2H3/b12-11+/t17-,20+/m1/s1 |
| InChIKey | NAHQFPHVCUEORZ-KSAKHOBUSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|