C19H23F2N3O2 — CID 164682595
tert-butyl N-[(1S,2S)-1-amino-1-(4-fluorophenyl)-1-(6-fluoro-3-pyridinyl)propan-2-yl]carbamate (PubChem CID 164682595) has the molecular formula C19H23F2N3O2 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-amino-1-(4-fluorophenyl)-1-(6-fluoro-3-pyridinyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-amino-1-(4-fluorophenyl)-1-(6-fluoro-3-pyridinyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 164682595 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-amino-1-(4-fluorophenyl)-1-(6-fluoro-3-pyridinyl)propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)[C@](N)(c1ccc(F)cc1)c1ccc(F)nc1 |
| InChI | InChI=1S/C19H23F2N3O2/c1-12(24-17(25)26-18(2,3)4)19(22,13-5-8-15(20)9-6-13)14-7-10-16(21)23-11-14/h5-12H,22H2,1-4H3,(H,24,25)/t12-,19-/m0/s1 |
| InChIKey | CNHGTFSDDHMEBV-BUXKBTBVSA-N |
| XLogP | 3.48 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|