C24H25F9O2 — CID 164682848
(8R,9S,13S,14S)-13-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 164682848) has the molecular formula C24H25F9O2 and a molecular weight of 516.44 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 164682848 |
| Molecular Formula | C24H25F9O2 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-(3,3,4,4,5,5,6,6,6-nonafluoro-1-hydroxyhexyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H25F9O2/c1-20-9-8-15-14-4-3-13(10-12(14)2-5-16(15)17(20)6-7-19(20)35)18(34)11-21(25,26)22(27,28)23(29,30)24(31,32)33/h3-4,10,15-18,34H,2,5-9,11H2,1H3/t15-,16-,17+,18?,20+/m1/s1 |
| InChIKey | OVYNOIIBUOOAGD-KEWVYSCRSA-N |
| XLogP | 7.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|