C31H31N3O — CID 164683048
2,3,11-trimethyl-5-[2-[(4-phenylphenyl)methylamino]ethyl]benzo[b][1,4]benzodiazepin-6-one (PubChem CID 164683048) has the molecular formula C31H31N3O and a molecular weight of 461.61 g/mol. Its IUPAC name is 2,3,11-trimethyl-5-[2-[(4-phenylphenyl)methylamino]ethyl]benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 2,3,11-trimethyl-5-[2-[(4-phenylphenyl)methylamino]ethyl]benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 164683048 |
| Molecular Formula | C31H31N3O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 2,3,11-trimethyl-5-[2-[(4-phenylphenyl)methylamino]ethyl]benzo[b][1,4]benzodiazepin-6-one |
| SMILES | Cc1cc2c(cc1C)N(C)c1ccccc1C(=O)N2CCNCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H31N3O/c1-22-19-29-30(20-23(22)2)34(31(35)27-11-7-8-12-28(27)33(29)3)18-17-32-21-24-13-15-26(16-14-24)25-9-5-4-6-10-25/h4-16,19-20,32H,17-18,21H2,1-3H3 |
| InChIKey | XHRNLVNPHJLYIV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|