C23H22N2O2 — CID 164683056
5-[2-(benzylamino)ethyl]-3-methylbenzo[b][1,4]benzoxazepin-6-one (PubChem CID 164683056) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-[2-(benzylamino)ethyl]-3-methylbenzo[b][1,4]benzoxazepin-6-one.
| Compound Name | 5-[2-(benzylamino)ethyl]-3-methylbenzo[b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 164683056 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 5-[2-(benzylamino)ethyl]-3-methylbenzo[b][1,4]benzoxazepin-6-one |
| SMILES | Cc1ccc2c(c1)N(CCNCc1ccccc1)C(=O)c1ccccc1O2 |
| InChI | InChI=1S/C23H22N2O2/c1-17-11-12-22-20(15-17)25(14-13-24-16-18-7-3-2-4-8-18)23(26)19-9-5-6-10-21(19)27-22/h2-12,15,24H,13-14,16H2,1H3 |
| InChIKey | QQRJGDTWJMCVTJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|