C17H18N2O2 — CID 164683082
6,12-dimethyl-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one (PubChem CID 164683082) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6,12-dimethyl-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one.
| Compound Name | 6,12-dimethyl-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one |
|---|---|
| PubChem CID | 164683082 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 6,12-dimethyl-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one |
| SMILES | Cc1ccc2c(c1)NCCN(C)C(=O)c1ccccc1O2 |
| InChI | InChI=1S/C17H18N2O2/c1-12-7-8-16-14(11-12)18-9-10-19(2)17(20)13-5-3-4-6-15(13)21-16/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | KSGCNSXNYJNDML-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |