C26H21NO2S — CID 164684254
8-(1,3-benzothiazol-2-yl)-3-methyl-4-(4-propan-2-ylphenyl)chromen-2-one (PubChem CID 164684254) has the molecular formula C26H21NO2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-2-yl)-3-methyl-4-(4-propan-2-ylphenyl)chromen-2-one.
| Compound Name | 8-(1,3-benzothiazol-2-yl)-3-methyl-4-(4-propan-2-ylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 164684254 |
| Molecular Formula | C26H21NO2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 8-(1,3-benzothiazol-2-yl)-3-methyl-4-(4-propan-2-ylphenyl)chromen-2-one |
| SMILES | Cc1c(-c2ccc(C(C)C)cc2)c2cccc(-c3nc4ccccc4s3)c2oc1=O |
| InChI | InChI=1S/C26H21NO2S/c1-15(2)17-11-13-18(14-12-17)23-16(3)26(28)29-24-19(23)7-6-8-20(24)25-27-21-9-4-5-10-22(21)30-25/h4-15H,1-3H3 |
| InChIKey | LNLKJMXASZUECQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|