C19H27NO4S — CID 164684301
[3-methyl-3-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl acetate (PubChem CID 164684301) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is [3-methyl-3-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl acetate.
| Compound Name | [3-methyl-3-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164684301 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [3-methyl-3-(4-methylpent-3-enyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1N(S(=O)(=O)c2ccc(C)cc2)C1(C)CCC=C(C)C |
| InChI | InChI=1S/C19H27NO4S/c1-14(2)7-6-12-19(5)18(13-24-16(4)21)20(19)25(22,23)17-10-8-15(3)9-11-17/h7-11,18H,6,12-13H2,1-5H3 |
| InChIKey | UGHZKDDSBOQIPM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|