C25H19NO2S — CID 164684623
8-(1,3-benzothiazol-2-yl)-4-(4-ethylphenyl)-3-methylchromen-2-one (PubChem CID 164684623) has the molecular formula C25H19NO2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-2-yl)-4-(4-ethylphenyl)-3-methylchromen-2-one.
| Compound Name | 8-(1,3-benzothiazol-2-yl)-4-(4-ethylphenyl)-3-methylchromen-2-one |
|---|---|
| PubChem CID | 164684623 |
| Molecular Formula | C25H19NO2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 8-(1,3-benzothiazol-2-yl)-4-(4-ethylphenyl)-3-methylchromen-2-one |
| SMILES | CCc1ccc(-c2c(C)c(=O)oc3c(-c4nc5ccccc5s4)cccc23)cc1 |
| InChI | InChI=1S/C25H19NO2S/c1-3-16-11-13-17(14-12-16)22-15(2)25(27)28-23-18(22)7-6-8-19(23)24-26-20-9-4-5-10-21(20)29-24/h4-14H,3H2,1-2H3 |
| InChIKey | LWEFXSAENOOSII-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|