C25H28O8S — CID 164685099
[(1S,3R,6R,8S,10R,12R)-12-(benzenesulfonylmethyl)-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl] acetate (PubChem CID 164685099) has the molecular formula C25H28O8S and a molecular weight of 488.56 g/mol. Its IUPAC name is [(1S,3R,6R,8S,10R,12R)-12-(benzenesulfonylmethyl)-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl] acetate.
| Compound Name | [(1S,3R,6R,8S,10R,12R)-12-(benzenesulfonylmethyl)-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl] acetate |
|---|---|
| PubChem CID | 164685099 |
| Molecular Formula | C25H28O8S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [(1S,3R,6R,8S,10R,12R)-12-(benzenesulfonylmethyl)-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl] acetate |
| SMILES | CC(=O)OC1C[C@@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3C[C@H]2O[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O8S/c1-16(26)30-22-13-19-20(32-24(22)15-34(27,28)18-10-6-3-7-11-18)12-21-23(31-19)14-29-25(33-21)17-8-4-2-5-9-17/h2-11,19-25H,12-15H2,1H3/t19-,20+,21-,22?,23+,24-,25+/m0/s1 |
| InChIKey | ZEWMEVCPVRDMIE-XRSDFAFNSA-N |
| XLogP | 2.82 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |