C15H22OSi — CID 164685271
trimethyl(5-phenylmethoxypenta-1,2-dien-3-yl)silane (PubChem CID 164685271) has the molecular formula C15H22OSi and a molecular weight of 246.43 g/mol. Its IUPAC name is trimethyl(5-phenylmethoxypenta-1,2-dien-3-yl)silane.
| Compound Name | trimethyl(5-phenylmethoxypenta-1,2-dien-3-yl)silane |
|---|---|
| PubChem CID | 164685271 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | trimethyl(5-phenylmethoxypenta-1,2-dien-3-yl)silane |
| SMILES | C=C=C(CCOCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H22OSi/c1-5-15(17(2,3)4)11-12-16-13-14-9-7-6-8-10-14/h6-10H,1,11-13H2,2-4H3 |
| InChIKey | XFDHWXNRLAGMBY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|