C19H34O3Si — CID 164685593
6-tert-butyl-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylpyran-2-one (PubChem CID 164685593) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is 6-tert-butyl-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylpyran-2-one.
| Compound Name | 6-tert-butyl-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylpyran-2-one |
|---|---|
| PubChem CID | 164685593 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 6-tert-butyl-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-methylpyran-2-one |
| SMILES | Cc1c(CCCO[Si](C)(C)C(C)(C)C)cc(C(C)(C)C)oc1=O |
| InChI | InChI=1S/C19H34O3Si/c1-14-15(13-16(18(2,3)4)22-17(14)20)11-10-12-21-23(8,9)19(5,6)7/h13H,10-12H2,1-9H3 |
| InChIKey | CWZIZFFOTCFWDE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|