C18H25ClO2Si — CID 164686274
ethyl 8-chloro-5-[dimethyl(phenyl)silyl]octa-3,4-dienoate (PubChem CID 164686274) has the molecular formula C18H25ClO2Si and a molecular weight of 336.94 g/mol. Its IUPAC name is ethyl 8-chloro-5-[dimethyl(phenyl)silyl]octa-3,4-dienoate.
| Compound Name | ethyl 8-chloro-5-[dimethyl(phenyl)silyl]octa-3,4-dienoate |
|---|---|
| PubChem CID | 164686274 |
| Molecular Formula | C18H25ClO2Si |
| Molecular Weight | 336.94 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl 8-chloro-5-[dimethyl(phenyl)silyl]octa-3,4-dienoate |
| SMILES | CCOC(=O)CC=C=C(CCCCl)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H25ClO2Si/c1-4-21-18(20)14-8-12-17(13-9-15-19)22(2,3)16-10-6-5-7-11-16/h5-8,10-11H,4,9,13-15H2,1-3H3 |
| InChIKey | SFUCKHJUBOXBEA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|