C13H18ClNO8P2 — CID 164687025
[(R)-chloro-[hydroxy-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethoxy]phosphoryl]methyl]phosphonic acid (PubChem CID 164687025) has the molecular formula C13H18ClNO8P2 and a molecular weight of 413.69 g/mol. Its IUPAC name is [(R)-chloro-[hydroxy-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethoxy]phosphoryl]methyl]phosphonic acid.
| Compound Name | [(R)-chloro-[hydroxy-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethoxy]phosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 164687025 |
| Molecular Formula | C13H18ClNO8P2 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | [(R)-chloro-[hydroxy-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethoxy]phosphoryl]methyl]phosphonic acid |
| SMILES | O=C([C@@H](OP(=O)(O)[C@H](Cl)P(=O)(O)O)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C13H18ClNO8P2/c14-13(24(17,18)19)25(20,21)23-11(10-4-2-1-3-5-10)12(16)15-6-8-22-9-7-15/h1-5,11,13H,6-9H2,(H,20,21)(H2,17,18,19)/t11-,13+/m0/s1 |
| InChIKey | QZQKIZXHRRDMDW-WCQYABFASA-N |
| XLogP | 1.49 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|