C14H26O2Si — CID 164687123
ethyl (2R)-2,6-dimethyl-3-trimethylsilylhepta-3,4-dienoate (PubChem CID 164687123) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is ethyl (2R)-2,6-dimethyl-3-trimethylsilylhepta-3,4-dienoate.
| Compound Name | ethyl (2R)-2,6-dimethyl-3-trimethylsilylhepta-3,4-dienoate |
|---|---|
| PubChem CID | 164687123 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | ethyl (2R)-2,6-dimethyl-3-trimethylsilylhepta-3,4-dienoate |
| SMILES | CCOC(=O)[C@@H](C)C(=C=CC(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-8-16-14(15)12(4)13(17(5,6)7)10-9-11(2)3/h9,11-12H,8H2,1-7H3/t10?,12-/m0/s1 |
| InChIKey | TUIIIQMLWFGJLS-KFJBMODSSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|