C17H25BFNO3 — CID 164687237
N-[(4-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanamide (PubChem CID 164687237) has the molecular formula C17H25BFNO3 and a molecular weight of 321.20 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanamide |
|---|---|
| PubChem CID | 164687237 |
| Molecular Formula | C17H25BFNO3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanamide |
| SMILES | CC(CC(=O)NCc1ccc(F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H25BFNO3/c1-12(18-22-16(2,3)17(4,5)23-18)10-15(21)20-11-13-6-8-14(19)9-7-13/h6-9,12H,10-11H2,1-5H3,(H,20,21) |
| InChIKey | IQCZCQXCRJXCRV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|