C32H36N4O6 — CID 164689262
(3R,8S)-14-methoxy-6-(5-pyridin-3-ylpentanoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione (PubChem CID 164689262) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is (3R,8S)-14-methoxy-6-(5-pyridin-3-ylpentanoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione.
| Compound Name | (3R,8S)-14-methoxy-6-(5-pyridin-3-ylpentanoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 164689262 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (3R,8S)-14-methoxy-6-(5-pyridin-3-ylpentanoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@@H]1CCN(C(=O)CCCCc3cccnc3)C[C@@H]1NC2=O |
| InChI | InChI=1S/C32H36N4O6/c1-40-28-13-10-24-17-29(28)41-21-30(37)34-19-23-8-11-25(12-9-23)42-27-14-16-36(20-26(27)35-32(24)39)31(38)7-3-2-5-22-6-4-15-33-18-22/h4,6,8-13,15,17-18,26-27H,2-3,5,7,14,16,19-21H2,1H3,(H,34,37)(H,35,39)/t26-,27+/m0/s1 |
| InChIKey | KDNVTQQEGZUPQM-RRPNLBNLSA-N |
| XLogP | 3.29 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|