C35H33N3O6 — CID 164694359
(3R,8S)-14-methoxy-6-(3-phenylbenzoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione (PubChem CID 164694359) has the molecular formula C35H33N3O6 and a molecular weight of 591.66 g/mol. Its IUPAC name is (3R,8S)-14-methoxy-6-(3-phenylbenzoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione.
| Compound Name | (3R,8S)-14-methoxy-6-(3-phenylbenzoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 164694359 |
| Molecular Formula | C35H33N3O6 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | (3R,8S)-14-methoxy-6-(3-phenylbenzoyl)-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@@H]1CCN(C(=O)c3cccc(-c4ccccc4)c3)C[C@@H]1NC2=O |
| InChI | InChI=1S/C35H33N3O6/c1-42-31-15-12-26-19-32(31)43-22-33(39)36-20-23-10-13-28(14-11-23)44-30-16-17-38(21-29(30)37-34(26)40)35(41)27-9-5-8-25(18-27)24-6-3-2-4-7-24/h2-15,18-19,29-30H,16-17,20-22H2,1H3,(H,36,39)(H,37,40)/t29-,30+/m0/s1 |
| InChIKey | QRMFMLYMTZZVGO-XZWHSSHBSA-N |
| XLogP | 4.46 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |