C14H17N7O — CID 164689364
3-[[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-5-methyl-1H-pyrazole-4-carbonitrile (PubChem CID 164689364) has the molecular formula C14H17N7O and a molecular weight of 299.34 g/mol. Its IUPAC name is 3-[[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-5-methyl-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-[[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-5-methyl-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 164689364 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-[[4-(3-hydroxypiperidin-1-yl)pyrimidin-2-yl]amino]-5-methyl-1H-pyrazole-4-carbonitrile |
| SMILES | Cc1[nH]nc(Nc2nccc(N3CCCC(O)C3)n2)c1C#N |
| InChI | InChI=1S/C14H17N7O/c1-9-11(7-15)13(20-19-9)18-14-16-5-4-12(17-14)21-6-2-3-10(22)8-21/h4-5,10,22H,2-3,6,8H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | ACKKITAMMINRAG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |