C18H21NO5 — CID 164689640
2-(1,3-benzodioxol-5-yl)-1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone (PubChem CID 164689640) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone |
|---|---|
| PubChem CID | 164689640 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]ethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N1C[C@H]2[C@@H](CO)[C@@H]3CC[C@@]2(C1)O3 |
| InChI | InChI=1S/C18H21NO5/c20-8-12-13-7-19(9-18(13)4-3-14(12)24-18)17(21)6-11-1-2-15-16(5-11)23-10-22-15/h1-2,5,12-14,20H,3-4,6-10H2/t12-,13+,14+,18+/m1/s1 |
| InChIKey | PUBODHVQEZZFPO-COJSNBRMSA-N |
| XLogP | 0.96 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |