C24H26N2O6 — CID 172655665
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-3-carbonyl]-4-methylpyridin-2-one (PubChem CID 172655665) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-3-carbonyl]-4-methylpyridin-2-one.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-3-carbonyl]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 172655665 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1R,5R,6S,7S)-6-(hydroxymethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-3-carbonyl]-4-methylpyridin-2-one |
| SMILES | Cc1ccn(Cc2ccc3c(c2)OCO3)c(=O)c1C(=O)N1C[C@H]2[C@@H](CO)[C@@H]3CC[C@@]2(C1)O3 |
| InChI | InChI=1S/C24H26N2O6/c1-14-5-7-25(9-15-2-3-19-20(8-15)31-13-30-19)22(28)21(14)23(29)26-10-17-16(11-27)18-4-6-24(17,12-26)32-18/h2-3,5,7-8,16-18,27H,4,6,9-13H2,1H3/t16-,17+,18+,24+/m1/s1 |
| InChIKey | YYLLQQZVHANDAP-REYXVDKWSA-N |
| XLogP | 1.55 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |