C22H33N3O2 — CID 164690093
6-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one (PubChem CID 164690093) has the molecular formula C22H33N3O2 and a molecular weight of 371.52 g/mol. Its IUPAC name is 6-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 164690093 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 6-[(1R,2S,8S,9S)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyridin-2-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(C(=O)c3cccc(=O)[nH]3)C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C22H33N3O2/c1-15(2)9-10-20-17-12-16(19-7-3-4-11-25(19)20)13-24(14-17)22(27)18-6-5-8-21(26)23-18/h5-6,8,15-17,19-20H,3-4,7,9-14H2,1-2H3,(H,23,26)/t16-,17+,19+,20+/m1/s1 |
| InChIKey | QQJPWEGPYJJBTF-UMGGQSCQSA-N |
| XLogP | 3.13 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |