C24H26FN3O6 — CID 164693867
(3R,8S)-6-acetyl-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione (PubChem CID 164693867) has the molecular formula C24H26FN3O6 and a molecular weight of 471.49 g/mol. Its IUPAC name is (3R,8S)-6-acetyl-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione.
| Compound Name | (3R,8S)-6-acetyl-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 164693867 |
| Molecular Formula | C24H26FN3O6 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (3R,8S)-6-acetyl-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1cc(F)cc(c1)O[C@@H]1CCN(C(C)=O)C[C@@H]1NC2=O |
| InChI | InChI=1S/C24H26FN3O6/c1-14(29)28-6-5-20-19(12-28)27-24(31)16-3-4-21(32-2)22(9-16)33-13-23(30)26-11-15-7-17(25)10-18(8-15)34-20/h3-4,7-10,19-20H,5-6,11-13H2,1-2H3,(H,26,30)(H,27,31)/t19-,20+/m0/s1 |
| InChIKey | ZAYJSSHRXDSRLW-VQTJNVASSA-N |
| XLogP | 1.64 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |