C29H30FN5O8 — CID 166600118
(3R,8S)-6-(6-aminopyridine-2-carbonyl)-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione;formic acid (PubChem CID 166600118) has the molecular formula C29H30FN5O8 and a molecular weight of 595.58 g/mol. Its IUPAC name is (3R,8S)-6-(6-aminopyridine-2-carbonyl)-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione;formic acid.
| Compound Name | (3R,8S)-6-(6-aminopyridine-2-carbonyl)-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione;formic acid |
|---|---|
| PubChem CID | 166600118 |
| Molecular Formula | C29H30FN5O8 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | (3R,8S)-6-(6-aminopyridine-2-carbonyl)-23-fluoro-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione;formic acid |
| SMILES | COc1ccc2cc1OCC(=O)NCc1cc(F)cc(c1)O[C@@H]1CCN(C(=O)c3cccc(N)n3)C[C@@H]1NC2=O.O=CO |
| InChI | InChI=1S/C28H28FN5O6.CH2O2/c1-38-23-6-5-17-11-24(23)39-15-26(35)31-13-16-9-18(29)12-19(10-16)40-22-7-8-34(14-21(22)33-27(17)36)28(37)20-3-2-4-25(30)32-20;2-1-3/h2-6,9-12,21-22H,7-8,13-15H2,1H3,(H2,30,32)(H,31,35)(H,33,36);1H,(H,2,3)/t21-,22+;/m0./s1 |
| InChIKey | DQWDEPZZDQHVKW-UMIAIAFLSA-N |
| XLogP | 1.61 |
| TPSA | 182.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|