C20H23N5O2 — CID 164695559
(2,4-dimethyl-1,3-oxazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 164695559) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-oxazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | (2,4-dimethyl-1,3-oxazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 164695559 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (2,4-dimethyl-1,3-oxazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CCn3nc(-c4ccccc4)nc3[C@@H]2C(C)C)o1 |
| InChI | InChI=1S/C20H23N5O2/c1-12(2)16-19-22-18(15-8-6-5-7-9-15)23-25(19)11-10-24(16)20(26)17-13(3)21-14(4)27-17/h5-9,12,16H,10-11H2,1-4H3/t16-/m0/s1 |
| InChIKey | RBPPXMWDKQXNSY-INIZCTEOSA-N |
| XLogP | 3.40 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |