C21H25N5O3S — CID 166598403
(2,4-dimethyl-1,3-thiazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone;formic acid (PubChem CID 166598403) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone;formic acid.
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone;formic acid |
|---|---|
| PubChem CID | 166598403 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[(8S)-2-phenyl-8-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methanone;formic acid |
| SMILES | Cc1nc(C)c(C(=O)N2CCn3nc(-c4ccccc4)nc3[C@@H]2C(C)C)s1.O=CO |
| InChI | InChI=1S/C20H23N5OS.CH2O2/c1-12(2)16-19-22-18(15-8-6-5-7-9-15)23-25(19)11-10-24(16)20(26)17-13(3)21-14(4)27-17;2-1-3/h5-9,12,16H,10-11H2,1-4H3;1H,(H,2,3)/t16-;/m0./s1 |
| InChIKey | WQUIZVIUKMNFBN-NTISSMGPSA-N |
| XLogP | 3.57 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|