C37H47N7O6 — CID 164698999
(15R,18S)-18-(4-aminobutyl)-15-benzyl-10-(pyridine-3-carbonyl)-2-oxa-5,10,13,16,19-pentazabicyclo[20.3.1]hexacosa-1(25),22(26),23-triene-6,14,17,20-tetrone (PubChem CID 164698999) has the molecular formula C37H47N7O6 and a molecular weight of 685.83 g/mol. Its IUPAC name is (15R,18S)-18-(4-aminobutyl)-15-benzyl-10-(pyridine-3-carbonyl)-2-oxa-5,10,13,16,19-pentazabicyclo[20.3.1]hexacosa-1(25),22(26),23-triene-6,14,17,20-tetrone.
| Compound Name | (15R,18S)-18-(4-aminobutyl)-15-benzyl-10-(pyridine-3-carbonyl)-2-oxa-5,10,13,16,19-pentazabicyclo[20.3.1]hexacosa-1(25),22(26),23-triene-6,14,17,20-tetrone |
|---|---|
| PubChem CID | 164698999 |
| Molecular Formula | C37H47N7O6 |
| Molecular Weight | 685.83 g/mol |
| Exact Mass | 685.36 |
| IUPAC Name | (15R,18S)-18-(4-aminobutyl)-15-benzyl-10-(pyridine-3-carbonyl)-2-oxa-5,10,13,16,19-pentazabicyclo[20.3.1]hexacosa-1(25),22(26),23-triene-6,14,17,20-tetrone |
| SMILES | NCCCC[C@@H]1NC(=O)Cc2cccc(c2)OCCNC(=O)CCCN(C(=O)c2cccnc2)CCNC(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C37H47N7O6/c38-16-5-4-14-31-36(48)43-32(24-27-9-2-1-3-10-27)35(47)41-18-21-44(37(49)29-12-7-17-39-26-29)20-8-15-33(45)40-19-22-50-30-13-6-11-28(23-30)25-34(46)42-31/h1-3,6-7,9-13,17,23,26,31-32H,4-5,8,14-16,18-22,24-25,38H2,(H,40,45)(H,41,47)(H,42,46)(H,43,48)/t31-,32+/m0/s1 |
| InChIKey | LPDRZGNAYLCSGI-AJQTZOPKSA-N |
| XLogP | 1.51 |
| TPSA | 184.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.83 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|