C23H34F3N5O4 — CID 164701736
N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4,4-dimethylpiperidine-2-carboxamide (PubChem CID 164701736) has the molecular formula C23H34F3N5O4 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4,4-dimethylpiperidine-2-carboxamide.
| Compound Name | N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4,4-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 164701736 |
| Molecular Formula | C23H34F3N5O4 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-1-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4,4-dimethylpiperidine-2-carboxamide |
| SMILES | CC1(C)CCN(C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C(C(=O)N[C@H](C#N)C[C@@H]2CCNC2=O)C1 |
| InChI | InChI=1S/C23H34F3N5O4/c1-21(2,3)16(30-20(35)23(24,25)26)19(34)31-9-7-22(4,5)11-15(31)18(33)29-14(12-27)10-13-6-8-28-17(13)32/h13-16H,6-11H2,1-5H3,(H,28,32)(H,29,33)(H,30,35)/t13-,14-,15?,16+/m0/s1 |
| InChIKey | NXIPBCMRTQDNAU-FCMBSTCGSA-N |
| XLogP | 1.63 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |